C23H21ClN8O2S — CID 126562721
7-[[4-(3-aminopyrrolidin-1-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-2,3-dihydropyridazino[4,5-b]quinoline-1,4-dione (PubChem CID 126562721) has the molecular formula C23H21ClN8O2S and a molecular weight of 509.00 g/mol. Its IUPAC name is 7-[[4-(3-aminopyrrolidin-1-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-2,3-dihydropyridazino[4,5-b]quinoline-1,4-dione.
| Compound Name | 7-[[4-(3-aminopyrrolidin-1-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-2,3-dihydropyridazino[4,5-b]quinoline-1,4-dione |
|---|---|
| PubChem CID | 126562721 |
| Molecular Formula | C23H21ClN8O2S |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 7-[[4-(3-aminopyrrolidin-1-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-2,3-dihydropyridazino[4,5-b]quinoline-1,4-dione |
| SMILES | CCc1[nH]c2nc(Sc3ccc4cc5c(=O)[nH][nH]c(=O)c5nc4c3)nc(N3CCC(N)C3)c2c1Cl |
| InChI | InChI=1S/C23H21ClN8O2S/c1-2-14-17(24)16-19(27-14)28-23(29-20(16)32-6-5-11(25)9-32)35-12-4-3-10-7-13-18(26-15(10)8-12)22(34)31-30-21(13)33/h3-4,7-8,11H,2,5-6,9,25H2,1H3,(H,30,33)(H,31,34)(H,27,28,29) |
| InChIKey | JZBCUWCYYNQFRO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|