C23H21ClN6S — CID 126551101
(3S)-1-[5-chloro-6-ethyl-2-(3-ethynylquinolin-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 126551101) has the molecular formula C23H21ClN6S and a molecular weight of 448.98 g/mol. Its IUPAC name is (3S)-1-[5-chloro-6-ethyl-2-(3-ethynylquinolin-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[5-chloro-6-ethyl-2-(3-ethynylquinolin-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 126551101 |
| Molecular Formula | C23H21ClN6S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (3S)-1-[5-chloro-6-ethyl-2-(3-ethynylquinolin-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | C#Cc1cnc2cc(Sc3nc(N4CC[C@H](N)C4)c4c(Cl)c(CC)[nH]c4n3)ccc2c1 |
| InChI | InChI=1S/C23H21ClN6S/c1-3-13-9-14-5-6-16(10-18(14)26-11-13)31-23-28-21-19(20(24)17(4-2)27-21)22(29-23)30-8-7-15(25)12-30/h1,5-6,9-11,15H,4,7-8,12,25H2,2H3,(H,27,28,29)/t15-/m0/s1 |
| InChIKey | MDUCTSZVOYHOHB-HNNXBMFYSA-N |
| XLogP | 4.39 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|