C21H23ClN7S+ — CID 161170797
(3S)-1-[5-chloro-6-ethyl-2-(1-methylquinoxalin-1-ium-6-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 161170797) has the molecular formula C21H23ClN7S+ and a molecular weight of 440.98 g/mol. Its IUPAC name is (3S)-1-[5-chloro-6-ethyl-2-(1-methylquinoxalin-1-ium-6-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[5-chloro-6-ethyl-2-(1-methylquinoxalin-1-ium-6-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 161170797 |
| Molecular Formula | C21H23ClN7S+ |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (3S)-1-[5-chloro-6-ethyl-2-(1-methylquinoxalin-1-ium-6-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | CCc1[nH]c2nc(Sc3ccc4c(c3)ncc[n+]4C)nc(N3CC[C@H](N)C3)c2c1Cl |
| InChI | InChI=1S/C21H23ClN7S/c1-3-14-18(22)17-19(25-14)26-21(27-20(17)29-8-6-12(23)11-29)30-13-4-5-16-15(10-13)24-7-9-28(16)2/h4-5,7,9-10,12H,3,6,8,11,23H2,1-2H3,(H,25,26,27)/q+1/t12-/m0/s1 |
| InChIKey | QECLRAVIZIFMJI-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|