C24H26ClN7OS — CID 71716482
1-[5-chloro-6-ethyl-2-[(5-oxido-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-5-ium-7-yl)sulfanyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 71716482) has the molecular formula C24H26ClN7OS and a molecular weight of 496.04 g/mol. Its IUPAC name is 1-[5-chloro-6-ethyl-2-[(5-oxido-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-5-ium-7-yl)sulfanyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | 1-[5-chloro-6-ethyl-2-[(5-oxido-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-5-ium-7-yl)sulfanyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 71716482 |
| Molecular Formula | C24H26ClN7OS |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[5-chloro-6-ethyl-2-[(5-oxido-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-5-ium-7-yl)sulfanyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | CCc1[nH]c2nc(Sc3ccc4cc5c([n+]([O-])c4c3)CCNC5)nc(N3CCC(N)C3)c2c1Cl |
| InChI | InChI=1S/C24H26ClN7OS/c1-2-17-21(25)20-22(28-17)29-24(30-23(20)31-8-6-15(26)12-31)34-16-4-3-13-9-14-11-27-7-5-18(14)32(33)19(13)10-16/h3-4,9-10,15,27H,2,5-8,11-12,26H2,1H3,(H,28,29,30) |
| InChIKey | FUZVHVTUWOLURD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|