C17H15NO — CID 158849311
5-(6-isocyano-2,3-dihydro-1H-inden-4-yl)-2-methylphenol (PubChem CID 158849311) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-(6-isocyano-2,3-dihydro-1H-inden-4-yl)-2-methylphenol.
| Compound Name | 5-(6-isocyano-2,3-dihydro-1H-inden-4-yl)-2-methylphenol |
|---|---|
| PubChem CID | 158849311 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 5-(6-isocyano-2,3-dihydro-1H-inden-4-yl)-2-methylphenol |
| SMILES | [C-]#[N+]c1cc2c(c(-c3ccc(C)c(O)c3)c1)CCC2 |
| InChI | InChI=1S/C17H15NO/c1-11-6-7-13(9-17(11)19)16-10-14(18-2)8-12-4-3-5-15(12)16/h6-10,19H,3-5H2,1H3 |
| InChIKey | KNUFPFJXIKHOJH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|