C17H13NO3 — CID 140895193
2-hydroxy-4-(6-isocyano-2,3-dihydro-1H-inden-4-yl)benzoic acid (PubChem CID 140895193) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-hydroxy-4-(6-isocyano-2,3-dihydro-1H-inden-4-yl)benzoic acid.
| Compound Name | 2-hydroxy-4-(6-isocyano-2,3-dihydro-1H-inden-4-yl)benzoic acid |
|---|---|
| PubChem CID | 140895193 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-hydroxy-4-(6-isocyano-2,3-dihydro-1H-inden-4-yl)benzoic acid |
| SMILES | [C-]#[N+]c1cc2c(c(-c3ccc(C(=O)O)c(O)c3)c1)CCC2 |
| InChI | InChI=1S/C17H13NO3/c1-18-12-7-10-3-2-4-13(10)15(9-12)11-5-6-14(17(20)21)16(19)8-11/h5-9,19H,2-4H2,(H,20,21) |
| InChIKey | HKJFKZRIOKKBHV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|