C14H18N4OSe — CID 158850448
2-methyl-5-[(2-methylselanyl-5-propan-2-yl-4-pyridinyl)oxy]pyrimidin-4-amine (PubChem CID 158850448) has the molecular formula C14H18N4OSe and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-methyl-5-[(2-methylselanyl-5-propan-2-yl-4-pyridinyl)oxy]pyrimidin-4-amine.
| Compound Name | 2-methyl-5-[(2-methylselanyl-5-propan-2-yl-4-pyridinyl)oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158850448 |
| Molecular Formula | C14H18N4OSe |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-methyl-5-[(2-methylselanyl-5-propan-2-yl-4-pyridinyl)oxy]pyrimidin-4-amine |
| SMILES | C[Se]c1cc(Oc2cnc(C)nc2N)c(C(C)C)cn1 |
| InChI | InChI=1S/C14H18N4OSe/c1-8(2)10-6-17-13(20-4)5-11(10)19-12-7-16-9(3)18-14(12)15/h5-8H,1-4H3,(H2,15,16,18) |
| InChIKey | KTROWMUIKUYDAA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|