About 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate
6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate (PubChem CID 158853353) has the molecular formula C18H21BrN4O4
and a molecular weight of 437.29 g/mol. Its IUPAC name is 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate.
Molecular Properties
| Compound Name | 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate |
| PubChem CID | 158853353 |
| Molecular Formula | C18H21BrN4O4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.COC(=O)/C=C/c1cccc(N)n1.Nc1cccc(Br)n1 |
| InChI | InChI=1S/C9H10N2O2.C5H5BrN2.C4H6O2/c1-13-9(12)6-5-7-3-2-4-8(10)11-7;6-4-2-1-3-5(7)8-4;1-3-4(5)6-2/h2-6H,1H3,(H2,10,11);1-3H,(H2,7,8);3H,1H2,2H3/b6-5+;; |
| InChIKey | IZSVITORSDKJDA-TXOOBNKBSA-N |
| XLogP | 2.62 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate?
The IUPAC name of 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate (CID 158853353) is 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate.
What is the SMILES notation for 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate?
The canonical SMILES for 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate is C=CC(=O)OC.COC(=O)/C=C/c1cccc(N)n1.Nc1cccc(Br)n1.
What is the InChIKey of 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate?
The InChIKey is IZSVITORSDKJDA-TXOOBNKBSA-N. The full InChI is InChI=1S/C9H10N2O2.C5H5BrN2.C4H6O2/c1-13-9(12)6-5-7-3-2-4-8(10)11-7;6-4-2-1-3-5(7)8-4;1-3-4(5)6-2/h2-6H,1H3,(H2,10,11);1-3H,(H2,7,8);3H,1H2,2H3/b6-5+;;.
What are the key properties of 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate?
6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate has a molecular weight of 437.29 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopyridin-2-amine;methyl (E)-3-(6-amino-2-pyridinyl)prop-2-enoate;methyl prop-2-enoate is sourced from PubChem (CID 158853353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).