C13H8Br2N2O — CID 11462766
(E)-1,3-bis(6-bromo-2-pyridinyl)prop-2-en-1-one (PubChem CID 11462766) has the molecular formula C13H8Br2N2O and a molecular weight of 368.03 g/mol. Its IUPAC name is (E)-1,3-bis(6-bromo-2-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(6-bromo-2-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11462766 |
| Molecular Formula | C13H8Br2N2O |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | (E)-1,3-bis(6-bromo-2-pyridinyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Br)n1)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H8Br2N2O/c14-12-5-1-3-9(16-12)7-8-11(18)10-4-2-6-13(15)17-10/h1-8H/b8-7+ |
| InChIKey | KKLRQVCSGHYSTP-BQYQJAHWSA-N |
| XLogP | 3.90 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|