About (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten
(6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten (PubChem CID 157026840) has the molecular formula C7H8BrN2OW-
and a molecular weight of 399.90 g/mol. Its IUPAC name is (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten.
Molecular Properties
| Compound Name | (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten |
| PubChem CID | 157026840 |
| Molecular Formula | C7H8BrN2OW- |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten |
| SMILES | CO.[N-]=Cc1cccc(Br)n1.[W] |
| InChI | InChI=1S/C6H4BrN2.CH4O.W/c7-6-3-1-2-5(4-8)9-6;1-2;/h1-4H;2H,1H3;/q-1;; |
| InChIKey | ZBADCBAXHSTRJH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten?
The IUPAC name of (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten (CID 157026840) is (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten.
What is the SMILES notation for (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten?
The canonical SMILES for (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten is CO.[N-]=Cc1cccc(Br)n1.[W].
What is the InChIKey of (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten?
The InChIKey is ZBADCBAXHSTRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN2.CH4O.W/c7-6-3-1-2-5(4-8)9-6;1-2;/h1-4H;2H,1H3;/q-1;;.
What are the key properties of (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten?
(6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten has a molecular weight of 399.90 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2-pyridinyl)methylideneazanide;methanol;tungsten is sourced from PubChem (CID 157026840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).