C10H8BrNO — CID 54391429
5-(6-bromo-2-pyridinyl)penta-2,4-dienal (PubChem CID 54391429) has the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. Its IUPAC name is 5-(6-bromo-2-pyridinyl)penta-2,4-dienal.
| Compound Name | 5-(6-bromo-2-pyridinyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 54391429 |
| Molecular Formula | C10H8BrNO |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 5-(6-bromo-2-pyridinyl)penta-2,4-dienal |
| SMILES | O=CC=CC=Cc1cccc(Br)n1 |
| InChI | InChI=1S/C10H8BrNO/c11-10-7-4-6-9(12-10)5-2-1-3-8-13/h1-8H |
| InChIKey | VGXKYBBVUNTZJN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|