C18H12N2O — CID 158854039
2-phenoxy-1,10-phenanthroline (PubChem CID 158854039) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-phenoxy-1,10-phenanthroline.
| Compound Name | 2-phenoxy-1,10-phenanthroline |
|---|---|
| PubChem CID | 158854039 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-phenoxy-1,10-phenanthroline |
| SMILES | c1ccc(Oc2ccc3ccc4cccnc4c3n2)cc1 |
| InChI | InChI=1S/C18H12N2O/c1-2-6-15(7-3-1)21-16-11-10-14-9-8-13-5-4-12-19-17(13)18(14)20-16/h1-12H |
| InChIKey | IZUUUQKLDCCPEH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|