C23H36O5S — CID 15885560
methyl 7-[(2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate (PubChem CID 15885560) has the molecular formula C23H36O5S and a molecular weight of 424.60 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 15885560 |
| Molecular Formula | C23H36O5S |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1[C@@H](CCC(O)CSc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H36O5S/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h4-6,9-10,17,19-22,24-26H,2-3,7-8,11-16H2,1H3/t17?,19?,20-,21+,22-/m1/s1 |
| InChIKey | CVQCOFJXLUFZDE-PILWYADHSA-N |
| XLogP | 3.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|