C16H22B2N2O7 — CID 158856764
4-boronobenzoic acid;methanamine;[4-(methylcarbamoyl)phenyl]boronic acid (PubChem CID 158856764) has the molecular formula C16H22B2N2O7 and a molecular weight of 375.98 g/mol. Its IUPAC name is 4-boronobenzoic acid;methanamine;[4-(methylcarbamoyl)phenyl]boronic acid.
| Compound Name | 4-boronobenzoic acid;methanamine;[4-(methylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 158856764 |
| Molecular Formula | C16H22B2N2O7 |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-boronobenzoic acid;methanamine;[4-(methylcarbamoyl)phenyl]boronic acid |
| SMILES | CN.CNC(=O)c1ccc(B(O)O)cc1.O=C(O)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C8H10BNO3.C7H7BO4.CH5N/c1-10-8(11)6-2-4-7(5-3-6)9(12)13;9-7(10)5-1-3-6(4-2-5)8(11)12;1-2/h2-5,12-13H,1H3,(H,10,11);1-4,11-12H,(H,9,10);2H2,1H3 |
| InChIKey | JADPGPOTWDJZFF-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|