ethane;[4-(methylcarbamoyl)phenyl]boronic acid

C10H16BNO3 — CID 145286024

IUPACethane;[4-(methylcarbamoyl)phenyl]boronic acid
SMILESCC.CNC(=O)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H10BNO3.C2H6/c1-10-8(11)6-2-4-7(5-3-6)9(12)13;1-2/h2-5,12-13H,1H3,(H,10,11);1-2H3
InChIKeyRTSNIGJMJWQKFA-UHFFFAOYSA-N
MW209.05 g/mol
LogP-0.25
Rot. Bonds2

About ethane;[4-(methylcarbamoyl)phenyl]boronic acid

ethane;[4-(methylcarbamoyl)phenyl]boronic acid (PubChem CID 145286024) has the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. Its IUPAC name is ethane;[4-(methylcarbamoyl)phenyl]boronic acid.

Molecular Properties

Compound Nameethane;[4-(methylcarbamoyl)phenyl]boronic acid
PubChem CID145286024
Molecular FormulaC10H16BNO3
Molecular Weight209.05 g/mol
Exact Mass209.12
IUPAC Nameethane;[4-(methylcarbamoyl)phenyl]boronic acid
SMILESCC.CNC(=O)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H10BNO3.C2H6/c1-10-8(11)6-2-4-7(5-3-6)9(12)13;1-2/h2-5,12-13H,1H3,(H,10,11);1-2H3
InChIKeyRTSNIGJMJWQKFA-UHFFFAOYSA-N
XLogP-0.25
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.05
LogP ≤ 5-0.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze ethane;[4-(methylcarbamoyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;[4-(methylcarbamoyl)phenyl]boronic acid?
The IUPAC name of ethane;[4-(methylcarbamoyl)phenyl]boronic acid (CID 145286024) is ethane;[4-(methylcarbamoyl)phenyl]boronic acid.
What is the SMILES notation for ethane;[4-(methylcarbamoyl)phenyl]boronic acid?
The canonical SMILES for ethane;[4-(methylcarbamoyl)phenyl]boronic acid is CC.CNC(=O)c1ccc(B(O)O)cc1.
What is the InChIKey of ethane;[4-(methylcarbamoyl)phenyl]boronic acid?
The InChIKey is RTSNIGJMJWQKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BNO3.C2H6/c1-10-8(11)6-2-4-7(5-3-6)9(12)13;1-2/h2-5,12-13H,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;[4-(methylcarbamoyl)phenyl]boronic acid?
ethane;[4-(methylcarbamoyl)phenyl]boronic acid has a molecular weight of 209.05 g/mol, XLogP of -0.25, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-(methylcarbamoyl)phenyl]boronic acid is sourced from PubChem (CID 145286024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).