C17H28BNO3 — CID 132554085
[4-[[(3R)-3,7-dimethyloctyl]carbamoyl]phenyl]boronic acid (PubChem CID 132554085) has the molecular formula C17H28BNO3 and a molecular weight of 305.23 g/mol. Its IUPAC name is [4-[[(3R)-3,7-dimethyloctyl]carbamoyl]phenyl]boronic acid.
| Compound Name | [4-[[(3R)-3,7-dimethyloctyl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 132554085 |
| Molecular Formula | C17H28BNO3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | [4-[[(3R)-3,7-dimethyloctyl]carbamoyl]phenyl]boronic acid |
| SMILES | CC(C)CCC[C@@H](C)CCNC(=O)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C17H28BNO3/c1-13(2)5-4-6-14(3)11-12-19-17(20)15-7-9-16(10-8-15)18(21)22/h7-10,13-14,21-22H,4-6,11-12H2,1-3H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | MDZHHAJGKHSXMQ-CQSZACIVSA-N |
| XLogP | 1.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|