C24H25FN2O — CID 158858244
4-[3-(6-fluoro-2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol (PubChem CID 158858244) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-[3-(6-fluoro-2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[3-(6-fluoro-2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 158858244 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[3-(6-fluoro-2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol |
| SMILES | [C-]#[N+]c1cc2c(-c3c(F)ccc(C)c3C)cn(C3CCC(O)CC3)c2cc1C |
| InChI | InChI=1S/C24H25FN2O/c1-14-5-10-21(25)24(16(14)3)20-13-27(17-6-8-18(28)9-7-17)23-11-15(2)22(26-4)12-19(20)23/h5,10-13,17-18,28H,6-9H2,1-3H3 |
| InChIKey | JPPJVIKXFRYWPQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|