C38H38ClFN4O4S2 — CID 158861210
N-(3-chlorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide;N-(3-fluorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide (PubChem CID 158861210) has the molecular formula C38H38ClFN4O4S2 and a molecular weight of 733.33 g/mol. Its IUPAC name is N-(3-chlorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide;N-(3-fluorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide;N-(3-fluorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide |
|---|---|
| PubChem CID | 158861210 |
| Molecular Formula | C38H38ClFN4O4S2 |
| Molecular Weight | 733.33 g/mol |
| Exact Mass | 732.20 |
| IUPAC Name | N-(3-chlorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide;N-(3-fluorophenyl)-9-methyl-5,6,7,8-tetrahydrocarbazole-3-sulfonamide |
| SMILES | Cn1c2c(c3cc(S(=O)(=O)Nc4cccc(Cl)c4)ccc31)CCCC2.Cn1c2c(c3cc(S(=O)(=O)Nc4cccc(F)c4)ccc31)CCCC2 |
| InChI | InChI=1S/C19H19ClN2O2S.C19H19FN2O2S/c2*1-22-18-8-3-2-7-16(18)17-12-15(9-10-19(17)22)25(23,24)21-14-6-4-5-13(20)11-14/h2*4-6,9-12,21H,2-3,7-8H2,1H3 |
| InChIKey | JARHSIFUITZITC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.33 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|