About 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate
5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate (PubChem CID 158863975) has the molecular formula C17H12F2N4O8S
and a molecular weight of 470.37 g/mol. Its IUPAC name is 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate |
| PubChem CID | 158863975 |
| Molecular Formula | C17H12F2N4O8S |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ncc(F)cc2[N+](=O)[O-])cc1.O=c1[nH]cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9FN2O5S.C5H3FN2O3/c1-8-2-4-10(5-3-8)21(18,19)20-12-11(15(16)17)6-9(13)7-14-12;6-3-1-4(8(10)11)5(9)7-2-3/h2-7H,1H3;1-2H,(H,7,9) |
| InChIKey | JAZLVKREJGPANV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 175.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate?
The IUPAC name of 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate (CID 158863975) is 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate.
What is the SMILES notation for 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate?
The canonical SMILES for 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2ncc(F)cc2[N+](=O)[O-])cc1.O=c1[nH]cc(F)cc1[N+](=O)[O-].
What is the InChIKey of 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate?
The InChIKey is JAZLVKREJGPANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O5S.C5H3FN2O3/c1-8-2-4-10(5-3-8)21(18,19)20-12-11(15(16)17)6-9(13)7-14-12;6-3-1-4(8(10)11)5(9)7-2-3/h2-7H,1H3;1-2H,(H,7,9).
What are the key properties of 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate?
5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate has a molecular weight of 470.37 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-nitro-1H-pyridin-2-one;(5-fluoro-3-nitro-2-pyridinyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 158863975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).