C19H17N5O7S — CID 101103564
[2-methyl-6-(2-methyl-6-nitroanilino)-5-nitropyrimidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 101103564) has the molecular formula C19H17N5O7S and a molecular weight of 459.44 g/mol. Its IUPAC name is [2-methyl-6-(2-methyl-6-nitroanilino)-5-nitropyrimidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-methyl-6-(2-methyl-6-nitroanilino)-5-nitropyrimidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101103564 |
| Molecular Formula | C19H17N5O7S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [2-methyl-6-(2-methyl-6-nitroanilino)-5-nitropyrimidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(C)nc(Nc3c(C)cccc3[N+](=O)[O-])c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N5O7S/c1-11-7-9-14(10-8-11)32(29,30)31-19-17(24(27)28)18(20-13(3)21-19)22-16-12(2)5-4-6-15(16)23(25)26/h4-10H,1-3H3,(H,20,21,22) |
| InChIKey | ARVZHQUDNHNISQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|