C12H13NO5 — CID 158867696
(3S)-3-[2-(5-hydroxy-3-pyridinyl)-2-oxoethyl]oxolane-3-carboxylic acid (PubChem CID 158867696) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is (3S)-3-[2-(5-hydroxy-3-pyridinyl)-2-oxoethyl]oxolane-3-carboxylic acid.
| Compound Name | (3S)-3-[2-(5-hydroxy-3-pyridinyl)-2-oxoethyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 158867696 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (3S)-3-[2-(5-hydroxy-3-pyridinyl)-2-oxoethyl]oxolane-3-carboxylic acid |
| SMILES | O=C(C[C@@]1(C(=O)O)CCOC1)c1cncc(O)c1 |
| InChI | InChI=1S/C12H13NO5/c14-9-3-8(5-13-6-9)10(15)4-12(11(16)17)1-2-18-7-12/h3,5-6,14H,1-2,4,7H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | JBLICCIOVGVIMZ-LBPRGKRZSA-N |
| XLogP | 0.85 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |