C21H42NO5P — CID 158870030
3-[[3-butoxy-2,2-bis(butoxymethyl)propoxy]-methylphosphanyl]oxypropanenitrile (PubChem CID 158870030) has the molecular formula C21H42NO5P and a molecular weight of 419.54 g/mol. Its IUPAC name is 3-[[3-butoxy-2,2-bis(butoxymethyl)propoxy]-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[3-butoxy-2,2-bis(butoxymethyl)propoxy]-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 158870030 |
| Molecular Formula | C21H42NO5P |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 3-[[3-butoxy-2,2-bis(butoxymethyl)propoxy]-methylphosphanyl]oxypropanenitrile |
| SMILES | CCCCOCC(COCCCC)(COCCCC)COP(C)OCCC#N |
| InChI | InChI=1S/C21H42NO5P/c1-5-8-13-23-17-21(18-24-14-9-6-2,19-25-15-10-7-3)20-27-28(4)26-16-11-12-22/h5-11,13-20H2,1-4H3 |
| InChIKey | BFSWARBESJPMBN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|