C28H48F6N5O8P — CID 144795138
N-[3-[2-[[2-cyanoethoxy-(dipropylamino)phosphanyl]oxymethyl]-2-(3-formamidopropoxymethyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propoxy]propyl]-2,2,2-trifluoroacetamide (PubChem CID 144795138) has the molecular formula C28H48F6N5O8P and a molecular weight of 727.68 g/mol. Its IUPAC name is N-[3-[2-[[2-cyanoethoxy-(dipropylamino)phosphanyl]oxymethyl]-2-(3-formamidopropoxymethyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propoxy]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[2-[[2-cyanoethoxy-(dipropylamino)phosphanyl]oxymethyl]-2-(3-formamidopropoxymethyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propoxy]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 144795138 |
| Molecular Formula | C28H48F6N5O8P |
| Molecular Weight | 727.68 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | N-[3-[2-[[2-cyanoethoxy-(dipropylamino)phosphanyl]oxymethyl]-2-(3-formamidopropoxymethyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propoxy]propyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCN(CCC)P(OCCC#N)OCC(COCCCNC=O)(COCCCNC(=O)C(F)(F)F)COCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H48F6N5O8P/c1-3-13-39(14-4-2)48(46-18-5-9-35)47-22-26(19-43-15-6-10-36-23-40,20-44-16-7-11-37-24(41)27(29,30)31)21-45-17-8-12-38-25(42)28(32,33)34/h23H,3-8,10-22H2,1-2H3,(H,36,40)(H,37,41)(H,38,42) |
| InChIKey | RLABXPPQVQYFCS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 160.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|