C22H28O6 — CID 158873409
1-(hydroperoxymethyl)-4-methylbenzene;(E)-4-[4-(hydroperoxymethyl)phenyl]but-3-en-2-one;propan-2-one (PubChem CID 158873409) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-(hydroperoxymethyl)-4-methylbenzene;(E)-4-[4-(hydroperoxymethyl)phenyl]but-3-en-2-one;propan-2-one.
| Compound Name | 1-(hydroperoxymethyl)-4-methylbenzene;(E)-4-[4-(hydroperoxymethyl)phenyl]but-3-en-2-one;propan-2-one |
|---|---|
| PubChem CID | 158873409 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-(hydroperoxymethyl)-4-methylbenzene;(E)-4-[4-(hydroperoxymethyl)phenyl]but-3-en-2-one;propan-2-one |
| SMILES | CC(=O)/C=C/c1ccc(COO)cc1.CC(C)=O.Cc1ccc(COO)cc1 |
| InChI | InChI=1S/C11H12O3.C8H10O2.C3H6O/c1-9(12)2-3-10-4-6-11(7-5-10)8-14-13;1-7-2-4-8(5-3-7)6-10-9;1-3(2)4/h2-7,13H,8H2,1H3;2-5,9H,6H2,1H3;1-2H3/b3-2+;; |
| InChIKey | JCCYVONZKSSBGA-WTVBWJGASA-N |
| XLogP | 4.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|