C21H21NO4 — CID 59038800
(2Z,4E)-2-acetyl-N-[4-(hydroperoxymethyl)phenyl]-5-(4-methylphenyl)penta-2,4-dienamide (PubChem CID 59038800) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2Z,4E)-2-acetyl-N-[4-(hydroperoxymethyl)phenyl]-5-(4-methylphenyl)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2-acetyl-N-[4-(hydroperoxymethyl)phenyl]-5-(4-methylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 59038800 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2Z,4E)-2-acetyl-N-[4-(hydroperoxymethyl)phenyl]-5-(4-methylphenyl)penta-2,4-dienamide |
| SMILES | CC(=O)/C(=C/C=C/c1ccc(C)cc1)C(=O)Nc1ccc(COO)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-15-6-8-17(9-7-15)4-3-5-20(16(2)23)21(24)22-19-12-10-18(11-13-19)14-26-25/h3-13,25H,14H2,1-2H3,(H,22,24)/b4-3+,20-5- |
| InChIKey | YUFLFKISPBAADB-DGWRTRROSA-N |
| XLogP | 4.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|