C27H34O4 — CID 158879366
1-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-4-prop-2-enoxybenzene;2-(4-prop-2-enoxyphenyl)ethanol (PubChem CID 158879366) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-4-prop-2-enoxybenzene;2-(4-prop-2-enoxyphenyl)ethanol.
| Compound Name | 1-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-4-prop-2-enoxybenzene;2-(4-prop-2-enoxyphenyl)ethanol |
|---|---|
| PubChem CID | 158879366 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-4-prop-2-enoxybenzene;2-(4-prop-2-enoxyphenyl)ethanol |
| SMILES | C=CCOc1ccc(CCO)cc1.C=CCOc1ccc(CCOC(=C)C(=C)C)cc1 |
| InChI | InChI=1S/C16H20O2.C11H14O2/c1-5-11-18-16-8-6-15(7-9-16)10-12-17-14(4)13(2)3;1-2-9-13-11-5-3-10(4-6-11)7-8-12/h5-9H,1-2,4,10-12H2,3H3;2-6,12H,1,7-9H2 |
| InChIKey | JCVOGCRWNXEGBR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|