C24H26N6O5S — CID 158883102
(9S)-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(1,3-thiazol-2-yl)propanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 158883102) has the molecular formula C24H26N6O5S and a molecular weight of 510.58 g/mol. Its IUPAC name is (9S)-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(1,3-thiazol-2-yl)propanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(1,3-thiazol-2-yl)propanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 158883102 |
| Molecular Formula | C24H26N6O5S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (9S)-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(1,3-thiazol-2-yl)propanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(CCc1nccs1)c1ccc2c(n1)N(C(=O)Nc1cc(OC[C@H](O)CO)ccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C24H26N6O5S/c31-13-16(32)14-35-17-5-7-25-21(11-17)28-24(34)30-15-6-9-29(12-15)19-2-1-18(27-23(19)30)20(33)3-4-22-26-8-10-36-22/h1-2,5,7-8,10-11,15-16,31-32H,3-4,6,9,12-14H2,(H,25,28,34)/t15-,16+/m0/s1 |
| InChIKey | XZIGNXWXYKFZGY-JKSUJKDBSA-N |
| XLogP | 2.11 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |