C18H29FN6O2 — CID 158884493
N-[3-[2-(3-methyl-1H-imidazol-3-ium-2-yl)hydrazinyl]-4-(3-propan-2-yloxypropylamino)phenyl]acetamide fluoride (PubChem CID 158884493) has the molecular formula C18H29FN6O2 and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-[2-(3-methyl-1H-imidazol-3-ium-2-yl)hydrazinyl]-4-(3-propan-2-yloxypropylamino)phenyl]acetamide fluoride.
| Compound Name | N-[3-[2-(3-methyl-1H-imidazol-3-ium-2-yl)hydrazinyl]-4-(3-propan-2-yloxypropylamino)phenyl]acetamide fluoride |
|---|---|
| PubChem CID | 158884493 |
| Molecular Formula | C18H29FN6O2 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[3-[2-(3-methyl-1H-imidazol-3-ium-2-yl)hydrazinyl]-4-(3-propan-2-yloxypropylamino)phenyl]acetamide fluoride |
| SMILES | CC(=O)Nc1ccc(NCCCOC(C)C)c(NNc2[nH]cc[n+]2C)c1.[F-] |
| InChI | InChI=1S/C18H28N6O2.FH/c1-13(2)26-11-5-8-19-16-7-6-15(21-14(3)25)12-17(16)22-23-18-20-9-10-24(18)4;/h6-7,9-10,12-13,19,22H,5,8,11H2,1-4H3,(H2,20,21,23,25);1H |
| InChIKey | XXCHSGLCZKCPKL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|