C24H23N9 — CID 158887140
4-(3-aminopyrazol-1-yl)benzonitrile;4-(3-piperazin-1-ylpyrazol-1-yl)benzonitrile (PubChem CID 158887140) has the molecular formula C24H23N9 and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-(3-aminopyrazol-1-yl)benzonitrile;4-(3-piperazin-1-ylpyrazol-1-yl)benzonitrile.
| Compound Name | 4-(3-aminopyrazol-1-yl)benzonitrile;4-(3-piperazin-1-ylpyrazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 158887140 |
| Molecular Formula | C24H23N9 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-(3-aminopyrazol-1-yl)benzonitrile;4-(3-piperazin-1-ylpyrazol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2ccc(N)n2)cc1.N#Cc1ccc(-n2ccc(N3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C14H15N5.C10H8N4/c15-11-12-1-3-13(4-2-12)19-8-5-14(17-19)18-9-6-16-7-10-18;11-7-8-1-3-9(4-2-8)14-6-5-10(12)13-14/h1-5,8,16H,6-7,9-10H2;1-6H,(H2,12,13) |
| InChIKey | JDTSBJPKACVVLG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |