C13H17N5 — CID 82513477
1-[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine (PubChem CID 82513477) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine.
| Compound Name | 1-[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 82513477 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-[4-(3-methyl-1,2,4-triazol-1-yl)phenyl]piperazine |
| SMILES | Cc1ncn(-c2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C13H17N5/c1-11-15-10-18(16-11)13-4-2-12(3-5-13)17-8-6-14-7-9-17/h2-5,10,14H,6-9H2,1H3 |
| InChIKey | SDLLXWYROSFVNL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|