C11H12N4 — CID 82512309
6-(3-methyl-1,2,4-triazol-1-yl)-2,3-dihydro-1H-indole (PubChem CID 82512309) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 6-(3-methyl-1,2,4-triazol-1-yl)-2,3-dihydro-1H-indole.
| Compound Name | 6-(3-methyl-1,2,4-triazol-1-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 82512309 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-(3-methyl-1,2,4-triazol-1-yl)-2,3-dihydro-1H-indole |
| SMILES | Cc1ncn(-c2ccc3c(c2)NCC3)n1 |
| InChI | InChI=1S/C11H12N4/c1-8-13-7-15(14-8)10-3-2-9-4-5-12-11(9)6-10/h2-3,6-7,12H,4-5H2,1H3 |
| InChIKey | MHNZQWIRXUWYKU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |