C10H10N4 — CID 82512186
6-(1,2,4-triazol-4-yl)-2,3-dihydro-1H-indole (PubChem CID 82512186) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 6-(1,2,4-triazol-4-yl)-2,3-dihydro-1H-indole.
| Compound Name | 6-(1,2,4-triazol-4-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 82512186 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-(1,2,4-triazol-4-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1-n1cnnc1)NCC2 |
| InChI | InChI=1S/C10H10N4/c1-2-9(14-6-12-13-7-14)5-10-8(1)3-4-11-10/h1-2,5-7,11H,3-4H2 |
| InChIKey | WGLBDOUAAQXPFD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |