C8H13N — CID 158890367
carbanide;1,4-dimethylpyridin-1-ium (PubChem CID 158890367) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is carbanide;1,4-dimethylpyridin-1-ium.
| Compound Name | carbanide;1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 158890367 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | carbanide;1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](C)cc1.[CH3-] |
| InChI | InChI=1S/C7H10N.CH3/c1-7-3-5-8(2)6-4-7;/h3-6H,1-2H3;1H3/q+1;-1 |
| InChIKey | JEDQRHFZHAMYGM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|