C15H27BSi — CID 15889222
[(2E)-3-bis(prop-2-enyl)boranylhexa-2,5-dien-2-yl]-trimethylsilane (PubChem CID 15889222) has the molecular formula C15H27BSi and a molecular weight of 246.28 g/mol. Its IUPAC name is [(2E)-3-bis(prop-2-enyl)boranylhexa-2,5-dien-2-yl]-trimethylsilane.
| Compound Name | [(2E)-3-bis(prop-2-enyl)boranylhexa-2,5-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15889222 |
| Molecular Formula | C15H27BSi |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | [(2E)-3-bis(prop-2-enyl)boranylhexa-2,5-dien-2-yl]-trimethylsilane |
| SMILES | C=CCB(CC=C)/C(CC=C)=C(/C)[Si](C)(C)C |
| InChI | InChI=1S/C15H27BSi/c1-8-11-15(14(4)17(5,6)7)16(12-9-2)13-10-3/h8-10H,1-3,11-13H2,4-7H3/b15-14- |
| InChIKey | RIPKJDRKODOODG-PFONDFGASA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|