C19H15NO2 — CID 158895580
6,11-dimethyl-12-methylidene-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaene (PubChem CID 158895580) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6,11-dimethyl-12-methylidene-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaene.
| Compound Name | 6,11-dimethyl-12-methylidene-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 158895580 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 6,11-dimethyl-12-methylidene-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaene |
| SMILES | C=C1Oc2nc3occ(C)c3cc2C(c2ccccc2)=C1C |
| InChI | InChI=1S/C19H15NO2/c1-11-10-21-18-15(11)9-16-17(14-7-5-4-6-8-14)12(2)13(3)22-19(16)20-18/h4-10H,3H2,1-2H3 |
| InChIKey | JEUDCKVXLZQFCC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |