C18H13NO3 — CID 122537725
6,11-dimethyl-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaen-12-one (PubChem CID 122537725) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6,11-dimethyl-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaen-12-one.
| Compound Name | 6,11-dimethyl-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaen-12-one |
|---|---|
| PubChem CID | 122537725 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 6,11-dimethyl-10-phenyl-4,13-dioxa-2-azatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10-pentaen-12-one |
| SMILES | Cc1c(-c2ccccc2)c2cc3c(C)coc3nc2oc1=O |
| InChI | InChI=1S/C18H13NO3/c1-10-9-21-16-13(10)8-14-15(12-6-4-3-5-7-12)11(2)18(20)22-17(14)19-16/h3-9H,1-2H3 |
| InChIKey | BMUWAWFVBVCNCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |