C23H28N8O — CID 158904746
2-[(5-piperazin-1-yl-2-pyridinyl)amino]spiro[8,9-dihydro-[1,3,5]triazino[1,2-b]indazole-10,1'-cyclohexane]-7-one (PubChem CID 158904746) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[(5-piperazin-1-yl-2-pyridinyl)amino]spiro[8,9-dihydro-[1,3,5]triazino[1,2-b]indazole-10,1'-cyclohexane]-7-one.
| Compound Name | 2-[(5-piperazin-1-yl-2-pyridinyl)amino]spiro[8,9-dihydro-[1,3,5]triazino[1,2-b]indazole-10,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 158904746 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[(5-piperazin-1-yl-2-pyridinyl)amino]spiro[8,9-dihydro-[1,3,5]triazino[1,2-b]indazole-10,1'-cyclohexane]-7-one |
| SMILES | O=C1CCC2(CCCCC2)c2c1nn1cnc(Nc3ccc(N4CCNCC4)cn3)nc21 |
| InChI | InChI=1S/C23H28N8O/c32-17-6-9-23(7-2-1-3-8-23)19-20(17)29-31-15-26-22(28-21(19)31)27-18-5-4-16(14-25-18)30-12-10-24-11-13-30/h4-5,14-15,24H,1-3,6-13H2,(H,25,27,28) |
| InChIKey | SIZUCCJIMZBMBC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |