2-hydroxypropyl(propyl)azanium hydroxide

C6H17NO2 — CID 158908409

IUPAC2-hydroxypropyl(propyl)azanium hydroxide
SMILESCCC[NH2+]CC(C)O.[OH-]
InChIInChI=1S/C6H15NO.H2O/c1-3-4-7-5-6(2)8;/h6-8H,3-5H2,1-2H3;1H2
InChIKeyRVNVSXIUIDARCQ-UHFFFAOYSA-N
MW135.21 g/mol
LogP-0.84
Rot. Bonds4

About 2-hydroxypropyl(propyl)azanium hydroxide

2-hydroxypropyl(propyl)azanium hydroxide (PubChem CID 158908409) has the molecular formula C6H17NO2 and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-hydroxypropyl(propyl)azanium hydroxide.

Molecular Properties

Compound Name2-hydroxypropyl(propyl)azanium hydroxide
PubChem CID158908409
Molecular FormulaC6H17NO2
Molecular Weight135.21 g/mol
Exact Mass135.13
IUPAC Name2-hydroxypropyl(propyl)azanium hydroxide
SMILESCCC[NH2+]CC(C)O.[OH-]
InChIInChI=1S/C6H15NO.H2O/c1-3-4-7-5-6(2)8;/h6-8H,3-5H2,1-2H3;1H2
InChIKeyRVNVSXIUIDARCQ-UHFFFAOYSA-N
XLogP-0.84
TPSA66.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.21
LogP ≤ 5-0.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hydroxypropyl(propyl)azanium hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxypropyl(propyl)azanium hydroxide?
The IUPAC name of 2-hydroxypropyl(propyl)azanium hydroxide (CID 158908409) is 2-hydroxypropyl(propyl)azanium hydroxide.
What is the SMILES notation for 2-hydroxypropyl(propyl)azanium hydroxide?
The canonical SMILES for 2-hydroxypropyl(propyl)azanium hydroxide is CCC[NH2+]CC(C)O.[OH-].
What is the InChIKey of 2-hydroxypropyl(propyl)azanium hydroxide?
The InChIKey is RVNVSXIUIDARCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.H2O/c1-3-4-7-5-6(2)8;/h6-8H,3-5H2,1-2H3;1H2.
What are the key properties of 2-hydroxypropyl(propyl)azanium hydroxide?
2-hydroxypropyl(propyl)azanium hydroxide has a molecular weight of 135.21 g/mol, XLogP of -0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl(propyl)azanium hydroxide is sourced from PubChem (CID 158908409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).