C8H19NO5 — CID 159125761
2,2-dihydroxyethyl(propyl)azanium;2-hydroxypropanoate (PubChem CID 159125761) has the molecular formula C8H19NO5 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2,2-dihydroxyethyl(propyl)azanium;2-hydroxypropanoate.
| Compound Name | 2,2-dihydroxyethyl(propyl)azanium;2-hydroxypropanoate |
|---|---|
| PubChem CID | 159125761 |
| Molecular Formula | C8H19NO5 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2,2-dihydroxyethyl(propyl)azanium;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].CCC[NH2+]CC(O)O |
| InChI | InChI=1S/C5H13NO2.C3H6O3/c1-2-3-6-4-5(7)8;1-2(4)3(5)6/h5-8H,2-4H2,1H3;2,4H,1H3,(H,5,6) |
| InChIKey | KGGFVZCLLOVPNW-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|