C20H44N2O4 — CID 139792553
(2S)-2-amino-3-methylbutanoate;2,2-dihydroxyethyl(tridecyl)azanium (PubChem CID 139792553) has the molecular formula C20H44N2O4 and a molecular weight of 376.58 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoate;2,2-dihydroxyethyl(tridecyl)azanium.
| Compound Name | (2S)-2-amino-3-methylbutanoate;2,2-dihydroxyethyl(tridecyl)azanium |
|---|---|
| PubChem CID | 139792553 |
| Molecular Formula | C20H44N2O4 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoate;2,2-dihydroxyethyl(tridecyl)azanium |
| SMILES | CC(C)[C@H](N)C(=O)[O-].CCCCCCCCCCCCC[NH2+]CC(O)O |
| InChI | InChI=1S/C15H33NO2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14-15(17)18;1-3(2)4(6)5(7)8/h15-18H,2-14H2,1H3;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | NVCAVTDCCYITAP-VWMHFEHESA-N |
| XLogP | 0.89 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|