About barium(2+);decane;2-propan-2-ylpropanedioate
barium(2+);decane;2-propan-2-ylpropanedioate (PubChem CID 175226108) has the molecular formula C16H30BaO4
and a molecular weight of 423.74 g/mol. Its IUPAC name is barium(2+);decane;2-propan-2-ylpropanedioate.
Molecular Properties
| Compound Name | barium(2+);decane;2-propan-2-ylpropanedioate |
| PubChem CID | 175226108 |
| Molecular Formula | C16H30BaO4 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | barium(2+);decane;2-propan-2-ylpropanedioate |
| SMILES | CC(C)C(C(=O)[O-])C(=O)[O-].CCCCCCCCCC.[Ba+2] |
| InChI | InChI=1S/C10H22.C6H10O4.Ba/c1-3-5-7-9-10-8-6-4-2;1-3(2)4(5(7)8)6(9)10;/h3-10H2,1-2H3;3-4H,1-2H3,(H,7,8)(H,9,10);/q;;+2/p-2 |
| InChIKey | DDILWTGTKVPXOO-UHFFFAOYSA-L |
| XLogP | 1.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);decane;2-propan-2-ylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);decane;2-propan-2-ylpropanedioate?
The IUPAC name of barium(2+);decane;2-propan-2-ylpropanedioate (CID 175226108) is barium(2+);decane;2-propan-2-ylpropanedioate.
What is the SMILES notation for barium(2+);decane;2-propan-2-ylpropanedioate?
The canonical SMILES for barium(2+);decane;2-propan-2-ylpropanedioate is CC(C)C(C(=O)[O-])C(=O)[O-].CCCCCCCCCC.[Ba+2].
What is the InChIKey of barium(2+);decane;2-propan-2-ylpropanedioate?
The InChIKey is DDILWTGTKVPXOO-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H22.C6H10O4.Ba/c1-3-5-7-9-10-8-6-4-2;1-3(2)4(5(7)8)6(9)10;/h3-10H2,1-2H3;3-4H,1-2H3,(H,7,8)(H,9,10);/q;;+2/p-2.
What are the key properties of barium(2+);decane;2-propan-2-ylpropanedioate?
barium(2+);decane;2-propan-2-ylpropanedioate has a molecular weight of 423.74 g/mol, XLogP of 1.52, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);decane;2-propan-2-ylpropanedioate is sourced from PubChem (CID 175226108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).