C14H32NO5+ — CID 59916970
octyl(2,3,4,5,6-pentahydroxyhexyl)azanium (PubChem CID 59916970) has the molecular formula C14H32NO5+ and a molecular weight of 294.41 g/mol. Its IUPAC name is octyl(2,3,4,5,6-pentahydroxyhexyl)azanium.
| Compound Name | octyl(2,3,4,5,6-pentahydroxyhexyl)azanium |
|---|---|
| PubChem CID | 59916970 |
| Molecular Formula | C14H32NO5+ |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | octyl(2,3,4,5,6-pentahydroxyhexyl)azanium |
| SMILES | CCCCCCCC[NH2+]CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H31NO5/c1-2-3-4-5-6-7-8-15-9-11(17)13(19)14(20)12(18)10-16/h11-20H,2-10H2,1H3/p+1 |
| InChIKey | ZRRNJJURLBXWLL-UHFFFAOYSA-O |
| XLogP | -1.65 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|