C10H19ClN2O3 — CID 110174803
[2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-propylazanium chloride (PubChem CID 110174803) has the molecular formula C10H19ClN2O3 and a molecular weight of 250.73 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-propylazanium chloride.
| Compound Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-propylazanium chloride |
|---|---|
| PubChem CID | 110174803 |
| Molecular Formula | C10H19ClN2O3 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-propylazanium chloride |
| SMILES | CCC[NH2+]CC(O)C1CC(=O)NC(=O)C1.[Cl-] |
| InChI | InChI=1S/C10H18N2O3.ClH/c1-2-3-11-6-8(13)7-4-9(14)12-10(15)5-7;/h7-8,11,13H,2-6H2,1H3,(H,12,14,15);1H |
| InChIKey | WVFPFUPNVQJWJG-UHFFFAOYSA-N |
| XLogP | -4.62 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|