C6H11NO3 — CID 55299892
(4S)-4-[(1S)-1,2-dihydroxyethyl]pyrrolidin-2-one (PubChem CID 55299892) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (4S)-4-[(1S)-1,2-dihydroxyethyl]pyrrolidin-2-one.
| Compound Name | (4S)-4-[(1S)-1,2-dihydroxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55299892 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (4S)-4-[(1S)-1,2-dihydroxyethyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H]([C@H](O)CO)CN1 |
| InChI | InChI=1S/C6H11NO3/c8-3-5(9)4-1-6(10)7-2-4/h4-5,8-9H,1-3H2,(H,7,10)/t4-,5+/m0/s1 |
| InChIKey | HBRVWGVRKZJQGF-CRCLSJGQSA-N |
| XLogP | -1.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |