C7H13NO4 — CID 146161426
(4S)-4-[(1S,2R)-1,2,3-trihydroxypropyl]pyrrolidin-2-one (PubChem CID 146161426) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (4S)-4-[(1S,2R)-1,2,3-trihydroxypropyl]pyrrolidin-2-one.
| Compound Name | (4S)-4-[(1S,2R)-1,2,3-trihydroxypropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146161426 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (4S)-4-[(1S,2R)-1,2,3-trihydroxypropyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H]([C@H](O)[C@H](O)CO)CN1 |
| InChI | InChI=1S/C7H13NO4/c9-3-5(10)7(12)4-1-6(11)8-2-4/h4-5,7,9-10,12H,1-3H2,(H,8,11)/t4-,5+,7-/m0/s1 |
| InChIKey | SFIIDTPLKSMOHZ-BFHQHQDPSA-N |
| XLogP | -2.16 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |