C15H23NO5 — CID 163007342
4-[(2R)-2-hydroxy-2-[(1S,3S,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione (PubChem CID 163007342) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-2-[(1S,3S,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione.
| Compound Name | 4-[(2R)-2-hydroxy-2-[(1S,3S,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163007342 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-[(2R)-2-hydroxy-2-[(1S,3S,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione |
| SMILES | C[C@@H]1C[C@@H]([C@H](O)CC2CC(=O)NC(=O)C2)C(=O)[C@@H](C)C1O |
| InChI | InChI=1S/C15H23NO5/c1-7-3-10(15(21)8(2)14(7)20)11(17)4-9-5-12(18)16-13(19)6-9/h7-11,14,17,20H,3-6H2,1-2H3,(H,16,18,19)/t7-,8+,10+,11-,14?/m1/s1 |
| InChIKey | JZQFWTNEUBVJCY-VWAKLNLZSA-N |
| XLogP | 0.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|