C19H21F2N3O2 — CID 158911810
(6S,7S)-3-cyclohexyl-6-fluoro-7-(3-fluorophenyl)-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 158911810) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is (6S,7S)-3-cyclohexyl-6-fluoro-7-(3-fluorophenyl)-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (6S,7S)-3-cyclohexyl-6-fluoro-7-(3-fluorophenyl)-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158911810 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (6S,7S)-3-cyclohexyl-6-fluoro-7-(3-fluorophenyl)-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)n1C1CCCCC1)C[C@H](F)[C@H](c1cccc(F)c1)N2 |
| InChI | InChI=1S/C19H21F2N3O2/c20-12-6-4-5-11(9-12)16-15(21)10-14-17(22-16)23-19(26)24(18(14)25)13-7-2-1-3-8-13/h4-6,9,13,15-16,22H,1-3,7-8,10H2,(H,23,26)/t15-,16-/m0/s1 |
| InChIKey | JGSZIHDWQICIJV-HOTGVXAUSA-N |
| XLogP | 3.23 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |