C16H23BN4O — CID 158917967
methyl-[[2-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]spiro[3.3]heptan-6-yl]methyl]borinic acid (PubChem CID 158917967) has the molecular formula C16H23BN4O and a molecular weight of 298.20 g/mol. Its IUPAC name is methyl-[[2-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]spiro[3.3]heptan-6-yl]methyl]borinic acid.
| Compound Name | methyl-[[2-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]spiro[3.3]heptan-6-yl]methyl]borinic acid |
|---|---|
| PubChem CID | 158917967 |
| Molecular Formula | C16H23BN4O |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | methyl-[[2-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]spiro[3.3]heptan-6-yl]methyl]borinic acid |
| SMILES | CB(O)CC1CC2(C1)CC(N(C)c1ncnc3[nH]ccc13)C2 |
| InChI | InChI=1S/C16H23BN4O/c1-17(22)9-11-5-16(6-11)7-12(8-16)21(2)15-13-3-4-18-14(13)19-10-20-15/h3-4,10-12,22H,5-9H2,1-2H3,(H,18,19,20) |
| InChIKey | JHLXUKBSFNFMNV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|