C12H21NO — CID 158918079
(4S)-9-imino-2,4-dimethyldec-1-en-3-one (PubChem CID 158918079) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (4S)-9-imino-2,4-dimethyldec-1-en-3-one.
| Compound Name | (4S)-9-imino-2,4-dimethyldec-1-en-3-one |
|---|---|
| PubChem CID | 158918079 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (4S)-9-imino-2,4-dimethyldec-1-en-3-one |
| SMILES | [H]/N=C(\C)CCCC[C@H](C)C(=O)C(=C)C |
| InChI | InChI=1S/C12H21NO/c1-9(2)12(14)10(3)7-5-6-8-11(4)13/h10,13H,1,5-8H2,2-4H3/b13-11+/t10-/m0/s1 |
| InChIKey | REVGNMPMQFZDRW-GYXQTMOZSA-N |
| XLogP | 3.37 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|