About methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid
methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid (PubChem CID 158920167) has the molecular formula C21H43NO5S
and a molecular weight of 421.64 g/mol. Its IUPAC name is methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid |
| PubChem CID | 158920167 |
| Molecular Formula | C21H43NO5S |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.COS(=O)(=O)CCN |
| InChI | InChI=1S/C18H34O2.C3H9NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7-8(5,6)3-2-4/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-4H2,1H3/b10-9-; |
| InChIKey | JHSVCPAYRKYFFU-KVVVOXFISA-N |
| XLogP | 5.03 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid?
The IUPAC name of methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid (CID 158920167) is methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid.
What is the SMILES notation for methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid?
The canonical SMILES for methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid is CCCCCCCC/C=C\CCCCCCCC(=O)O.COS(=O)(=O)CCN.
What is the InChIKey of methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid?
The InChIKey is JHSVCPAYRKYFFU-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C3H9NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7-8(5,6)3-2-4/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-4H2,1H3/b10-9-;.
What are the key properties of methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid?
methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid has a molecular weight of 421.64 g/mol, XLogP of 5.03, 18 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-aminoethanesulfonate;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 158920167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).